EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3[C@@]2(C)C1=O |
| InChI | InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,21-23H,1-4H3/t18-/m0/s1 |
| InChIKey | WEYVVCKOOFYHRW-SFHVURJKSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-usnic acid (CHEBI:38320) is a usnic acid (CHEBI:38319) |
| (+)-usnic acid (CHEBI:38320) is enantiomer of (−)-usnic acid (CHEBI:122) |
| Incoming Relation(s) |
| (−)-usnic acid (CHEBI:122) is enantiomer of (+)-usnic acid (CHEBI:38320) |
| IUPAC Name |
|---|
| (9bR)-2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzo[b,d]furan-1(9bH)-one |
| Synonyms | Source |
|---|---|
| d-Usnic acid | ChemIDplus |
| d-Usninic acid | ChemIDplus |
| (R)-usnic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4272511 | Beilstein |
| Beilstein:4765696 | Beilstein |
| CAS:7562-61-0 | ChemIDplus |