EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3[C@]2(C)C1=O |
| InChI | InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,21-23H,1-4H3/t18-/m1/s1 |
| InChIKey | WEYVVCKOOFYHRW-GOSISDBHSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-usnic acid (CHEBI:122) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| (−)-usnic acid (CHEBI:122) is a usnic acid (CHEBI:38319) |
| (−)-usnic acid (CHEBI:122) is conjugate acid of (−)-usnic acid(2−) (CHEBI:57266) |
| (−)-usnic acid (CHEBI:122) is enantiomer of (+)-usnic acid (CHEBI:38320) |
| Incoming Relation(s) |
| (−)-usnic acid(2−) (CHEBI:57266) is conjugate base of (−)-usnic acid (CHEBI:122) |
| (+)-usnic acid (CHEBI:38320) is enantiomer of (−)-usnic acid (CHEBI:122) |
| IUPAC Name |
|---|
| (9bS)-2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzo[b,d]furan-1(9bH)-one |
| Synonyms | Source |
|---|---|
| (S)-usnate | KEGG COMPOUND |
| (S)-Usnic acid | KEGG COMPOUND |
| (-)-Usnic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002413 | KNApSAcK |
| C10101 | KEGG COMPOUND |
| CPD-7411 | MetaCyc |
| LMPK13060002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4719209 | Beilstein |
| Beilstein:96698 | Beilstein |
| CAS:6159-66-6 | ChemIDplus |
| CAS:6159-66-6 | KEGG COMPOUND |