EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41N7O12 |
| Net Charge | 0 |
| Average Mass | 583.596 |
| Monoisotopic Mass | 583.28132 |
| SMILES | CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)CO)O[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H41N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h5-18,26,29-36H,3-4H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1 |
| InChIKey | ASXBYYWOLISCLQ-HZYVHMACSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrostreptomycin (CHEBI:38291) has role ophthalmology drug (CHEBI:66981) |
| dihydrostreptomycin (CHEBI:38291) is a streptomycins (CHEBI:26788) |
| Incoming Relation(s) |
| dihydrostreptomycin 3''-phosphate (CHEBI:27918) has functional parent dihydrostreptomycin (CHEBI:38291) |
| dihydrostreptomycin 3'',6-bisphosphate (CHEBI:28333) has functional parent dihydrostreptomycin (CHEBI:38291) |
| dihydrostreptomycin 3'α-phosphate (CHEBI:28703) has functional parent dihydrostreptomycin (CHEBI:38291) |
| dihydrostreptomycin 3'α,6-bisphosphate (CHEBI:17751) has functional parent dihydrostreptomycin (CHEBI:38291) |
| dihydrostreptomycin 6-phosphate (CHEBI:16505) has functional parent dihydrostreptomycin (CHEBI:38291) |
| IUPAC Name |
|---|
| 1,1'-[(1R,2R,3S,4R,5R,6S)-4-({5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-(hydroxymethyl)-α-L-lyxofuranosyl}oxy)-2,5,6-trihydroxycyclohexane-1,3-diyl]diguanidine |
| INN | Source |
|---|---|
| dihidroestreptomicina | WHO MedNet |
| Synonyms | Source |
|---|---|
| DHMS | ChemIDplus |
| Dihydrostreptomycin | KEGG COMPOUND |
| DST | ChemIDplus |
| N,N'''-[(1R,2R,3S,4R,5R,6S)-4-({5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-(hydroxymethyl)-α-L-lyxofuranosyl}oxy)-2,5,6-trihydroxycyclohexane-1,3-diyl]diguanidine | IUPAC |
| Streptomycin, dihydro- | ChEMBL |
| Citations |
|---|