EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42N7O14P |
| Net Charge | 0 |
| Average Mass | 647.576 |
| Monoisotopic Mass | 647.25274 |
| SMILES | CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@H]2COP(=O)(O)O)O[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H42N7O14P/c1-5-6(4-38-43(35,36)37)16(41-18-10(26-2)14(33)11(30)7(3-29)40-18)19(39-5)42-17-9(28-21(24)25)12(31)8(27-20(22)23)13(32)15(17)34/h5-19,26,29-34H,3-4H2,1-2H3,(H4,22,23,27)(H4,24,25,28)(H2,35,36,37)/t5-,6-,7-,8+,9-,10-,11-,12+,13-,14-,15+,16+,17+,18-,19-/m0/s1 |
| InChIKey | CYLJNXXMQIXPAD-PQMJGINDSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrostreptomycin 3'α-phosphate (CHEBI:28703) has functional parent dihydrostreptomycin (CHEBI:38291) |
| dihydrostreptomycin 3'α-phosphate (CHEBI:28703) is a streptomycin phosphate (CHEBI:26787) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R,5S,6R)-2,4-dicarbamimidamido-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-[(phosphonooxy)methyl]-α-L-lyxofuranoside |
| Synonym | Source |
|---|---|
| Dihydrostreptomycin 3'alpha-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04382 | KEGG COMPOUND |