EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22N2O8 |
| Net Charge | 0 |
| Average Mass | 322.314 |
| Monoisotopic Mass | 322.13762 |
| SMILES | O=C(O)[C@H](CCO)NCC[C@H](NCC[C@H](O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22N2O8/c15-6-3-8(11(19)20)13-4-1-7(10(17)18)14-5-2-9(16)12(21)22/h7-9,13-16H,1-6H2,(H,17,18)(H,19,20)(H,21,22)/t7-,8-,9-/m0/s1 |
| InChIKey | QUKMQOBHQMWLLR-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S,S)-avenic acid A (CHEBI:38154) has role phytosiderophore (CHEBI:38155) |
| (S,S,S)-avenic acid A (CHEBI:38154) is a avenic acid A (CHEBI:22678) |
| (S,S,S)-avenic acid A (CHEBI:38154) is enantiomer of (R,R,R)-avenic acid A (CHEBI:38153) |
| Incoming Relation(s) |
| (R,R,R)-avenic acid A (CHEBI:38153) is enantiomer of (S,S,S)-avenic acid A (CHEBI:38154) |
| IUPAC Name |
|---|
| N-[(3S)-3-carboxy-3-{[(3S)-3-carboxy-3-hydroxypropyl]amino}propyl]-L-homoserine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5298479 | Beilstein |
| Beilstein:5298480 | Beilstein |