EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22N2O8 |
| Net Charge | 0 |
| Average Mass | 322.314 |
| Monoisotopic Mass | 322.13762 |
| SMILES | O=C(O)C(O)CCNC(CCNC(CCO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22N2O8/c15-6-3-8(11(19)20)13-4-1-7(10(17)18)14-5-2-9(16)12(21)22/h7-9,13-16H,1-6H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | QUKMQOBHQMWLLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenic acid A (CHEBI:22678) has role iron(3+) chelator (CHEBI:24028) |
| avenic acid A (CHEBI:22678) is a tricarboxylic acid (CHEBI:27093) |
| Incoming Relation(s) |
| (R,R,R)-avenic acid A (CHEBI:38153) is a avenic acid A (CHEBI:22678) |
| (S,S,S)-avenic acid A (CHEBI:38154) is a avenic acid A (CHEBI:22678) |
| IUPAC Name |
|---|
| N-{3-carboxy-3-[(3-carboxy-3-hydroxypropyl)amino]propyl}homoserine |
| Synonym | Source |
|---|---|
| AVA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4539525 | Beilstein |