EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | CC(O)CCC[C@H]1C(=O)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C12H20O4/c1-8(13)3-2-4-10-9(7-12(15)16)5-6-11(10)14/h8-10,13H,2-7H2,1H3,(H,15,16)/t8?,9-,10-/m1/s1 |
| InChIKey | ZJPORBFEYXKGKA-VXRWAFEHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid (CHEBI:38152) is a dihydrojasmonic acid (CHEBI:23747) |
| Incoming Relation(s) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) has functional parent (−)-11-hydroxy-9,10-dihydrojasmonic acid (CHEBI:38152) |
| IUPAC Name |
|---|
| [(1R,2R)-2-(4-hydroxypentyl)-3-oxocyclopentyl]acetic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6970652 | Beilstein |