EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O9 |
| Net Charge | 0 |
| Average Mass | 390.429 |
| Monoisotopic Mass | 390.18898 |
| SMILES | CC(CCC[C@H]1C(=O)CC[C@@H]1CC(=O)O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H30O9/c1-9(26-18-17(25)16(24)15(23)13(8-19)27-18)3-2-4-11-10(7-14(21)22)5-6-12(11)20/h9-11,13,15-19,23-25H,2-8H2,1H3,(H,21,22)/t9?,10-,11-,13-,15-,16+,17-,18-/m1/s1 |
| InChIKey | QPYZJXJBZOQDGA-XGNCEZCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) has functional parent (−)-11-hydroxy-9,10-dihydrojasmonic acid (CHEBI:38152) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) has role plant metabolite (CHEBI:76924) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) is a dihydrojasmonic acid (CHEBI:23747) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) is a monosaccharide derivative (CHEBI:63367) |
| (−)-11-hydroxy-9,10-dihydrojasmonic acid 11-β-D-glucoside (CHEBI:18471) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| {(1R,2R)-2-[4-(β-D-glucopyranosyloxy)pentyl]-3-oxocyclopentyl}acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6985377 | Reaxys |