EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3 |
| Net Charge | 0 |
| Average Mass | 177.251 |
| Monoisotopic Mass | 177.12660 |
| SMILES | C/N=C(\NC)NCc1ccccc1 |
| InChI | InChI=1S/C10H15N3/c1-11-10(12-2)13-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H2,11,12,13) |
| InChIKey | NIVZHWNOUVJHKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bethanidine (CHEBI:37937) has role adrenergic antagonist (CHEBI:37887) |
| bethanidine (CHEBI:37937) has role antihypertensive agent (CHEBI:35674) |
| bethanidine (CHEBI:37937) is a guanidines (CHEBI:24436) |
| Incoming Relation(s) |
| bethanidine sulfate (CHEBI:31279) has functional parent bethanidine (CHEBI:37937) |
| IUPAC Name |
|---|
| 1-benzyl-2,3-dimethylguanidine |
| INNs | Source |
|---|---|
| betanidina | ChEBI |
| betanidine | ChEBI |
| bétanidine | ChEBI |
| betanidinum | ChEBI |
| Synonyms | Source |
|---|---|
| betanidine | ChemIDplus |
| N,N'-dimethyl-N''-(phenylmethyl)-guanidine | ChemIDplus |