EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C10H16N3.O4S |
| Net Charge | 0 |
| Average Mass | 452.581 |
| Monoisotopic Mass | 452.22057 |
| SMILES | CN/C(NCc1ccccc1)=[NH+]\C.CN/C(NCc1ccccc1)=[NH+]\C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C10H15N3.H2O4S/c2*1-11-10(12-2)13-8-9-6-4-3-5-7-9;1-5(2,3)4/h2*3-7H,8H2,1-2H3,(H2,11,12,13);(H2,1,2,3,4) |
| InChIKey | YTIJUXVIZLYQTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bethanidine sulfate (CHEBI:31279) has functional parent bethanidine (CHEBI:37937) |
| bethanidine sulfate (CHEBI:31279) has role antihypertensive agent (CHEBI:35674) |
| bethanidine sulfate (CHEBI:31279) is a alkylammonium sulfate (CHEBI:38015) |
| IUPAC Name |
|---|
| bis{N-[(benzylamino)(methylamino)methylidene]methanaminium} sulfate |
| Synonyms | Source |
|---|---|
| 1-benzyl-2,3-dimethylguanidine sulfate | ChemIDplus |
| 1-benzyl-2,3-dimethylguanidinium sulfate | ChemIDplus |
| bethanidine sulfate | ChemIDplus |
| N-benzyl-N',N''-dimethylguanidine sulfate | ChemIDplus |
| N,N'-dimethyl-N''-(phenylmethyl)guanidine sulfate (2:1) | ChemIDplus |
| Regulin | ChemIDplus |