EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21FN2O4 |
| Net Charge | 0 |
| Average Mass | 360.385 |
| Monoisotopic Mass | 360.14854 |
| SMILES | C[C@H]1CCc2c(N3CCC(O)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26)/t10-/m0/s1 |
| InChIKey | JYJTVFIEFKZWCJ-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nadifloxacin (CHEBI:37908) has role antibacterial agent (CHEBI:33282) |
| (S)-nadifloxacin (CHEBI:37908) is a nadifloxacin (CHEBI:31889) |
| (S)-nadifloxacin (CHEBI:37908) is enantiomer of (R)-nadifloxacin (CHEBI:37907) |
| Incoming Relation(s) |
| (R)-nadifloxacin (CHEBI:37907) is enantiomer of (S)-nadifloxacin (CHEBI:37908) |
| INNs | Source |
|---|---|
| levonadifloxacina | WHO MedNet |
| levonadifloxacine | WHO MedNet |
| Synonyms | Source |
|---|---|
| (5S)-9-fluoro-8-(4-hydroxypiperidin-1-yl)-5-methyl-1-oxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid | ChEBI |
| levonadifloxacin | ChEMBL |
| Levonadifloxacin | ChEMBL |
| Nadifloxacin, (s)- | ChEMBL |
| (s)-(-)-nadifloxacin | ChEMBL |
| WCK-771 FREE BASE | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7084299 | Beilstein |
| Citations |
|---|