EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21FN2O4 |
| Net Charge | 0 |
| Average Mass | 360.385 |
| Monoisotopic Mass | 360.14854 |
| SMILES | CC1CCc2c(N3CCC(O)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C19H21FN2O4/c1-10-2-3-12-16-13(18(24)14(19(25)26)9-22(10)16)8-15(20)17(12)21-6-4-11(23)5-7-21/h8-11,23H,2-7H2,1H3,(H,25,26) |
| InChIKey | JYJTVFIEFKZWCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nadifloxacin (CHEBI:31889) has role antibacterial drug (CHEBI:36047) |
| nadifloxacin (CHEBI:31889) is a heteroarylpiperidine (CHEBI:48585) |
| nadifloxacin (CHEBI:31889) is a hydroxypiperidine (CHEBI:48590) |
| nadifloxacin (CHEBI:31889) is a pyridoquinoline (CHEBI:38921) |
| nadifloxacin (CHEBI:31889) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| (R)-nadifloxacin (CHEBI:37907) is a nadifloxacin (CHEBI:31889) |
| (S)-nadifloxacin (CHEBI:37908) is a nadifloxacin (CHEBI:31889) |
| IUPAC Name |
|---|
| 9-fluoro-8-(4-hydroxypiperidin-1-yl)-5-methyl-1-oxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Acuatim | KEGG DRUG |
| Nadifloxacin | ChemIDplus |
| NDFX | KEGG DRUG |
| OPC-7251 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4212500 | Beilstein |
| CAS:124858-35-1 | ChemIDplus |