EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClFN5O5S |
| Net Charge | 0 |
| Average Mass | 429.817 |
| Monoisotopic Mass | 429.03100 |
| SMILES | CCOc1nc(F)cc2nc(S(=O)(=O)Nc3c(Cl)cccc3C(=O)OC)nn12 |
| InChI | InChI=1S/C15H13ClFN5O5S/c1-3-27-15-18-10(17)7-11-19-14(20-22(11)15)28(24,25)21-12-8(13(23)26-2)5-4-6-9(12)16/h4-7,21H,3H2,1-2H3 |
| InChIKey | BIKACRYIQSLICJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloransulam-methyl (CHEBI:3760) has functional parent cloransulam (CHEBI:131998) |
| cloransulam-methyl (CHEBI:3760) has role agrochemical (CHEBI:33286) |
| cloransulam-methyl (CHEBI:3760) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| cloransulam-methyl (CHEBI:3760) has role herbicide (CHEBI:24527) |
| cloransulam-methyl (CHEBI:3760) is a methyl ester (CHEBI:25248) |
| cloransulam-methyl (CHEBI:3760) is a monochlorobenzenes (CHEBI:83403) |
| cloransulam-methyl (CHEBI:3760) is a organofluorine compound (CHEBI:37143) |
| cloransulam-methyl (CHEBI:3760) is a sulfonamide (CHEBI:35358) |
| cloransulam-methyl (CHEBI:3760) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| methyl 3-chloro-2-{[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino}benzoate |
| Synonyms | Source |
|---|---|
| methyl 3-chloro-N-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-ylsulfonyl)anthranilate | Alan Wood's Pesticides |
| methyl 3-chloro-2-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-ylsulfonamido)benzoate | Alan Wood's Pesticides |
| methyl 3-chloro-2-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamido)benzoate | Alan Wood's Pesticides |
| methyl 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]benzoate | Alan Wood's Pesticides |
| cloransulam - methyl | ChemIDplus |
| DE 565 | ChemIDplus |
| Brand Name | Source |
|---|---|
| First Rate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10907 | KEGG COMPOUND |
| derivatives/cloransulam-methyl | Alan Wood's Pesticides |
| HMDB0033147 | HMDB |
| 1153 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7501727 | Reaxys |
| CAS:147150-35-4 | KEGG COMPOUND |
| CAS:147150-35-4 | ChemIDplus |
| CAS:147150-35-4 | Alan Wood's Pesticides |
| Citations |
|---|