EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11ClFN5O5S |
| Net Charge | 0 |
| Average Mass | 415.790 |
| Monoisotopic Mass | 415.01535 |
| SMILES | CCOc1nc(F)cc2nc(S(=O)(=O)Nc3c(Cl)cccc3C(=O)O)nn12 |
| InChI | InChI=1S/C14H11ClFN5O5S/c1-2-26-14-17-9(16)6-10-18-13(19-21(10)14)27(24,25)20-11-7(12(22)23)4-3-5-8(11)15/h3-6,20H,2H2,1H3,(H,22,23) |
| InChIKey | YIANBKOBVRMNPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloransulam (CHEBI:131998) has role herbicide (CHEBI:24527) |
| cloransulam (CHEBI:131998) is a aromatic ether (CHEBI:35618) |
| cloransulam (CHEBI:131998) is a monocarboxylic acid (CHEBI:25384) |
| cloransulam (CHEBI:131998) is a monochlorobenzenes (CHEBI:83403) |
| cloransulam (CHEBI:131998) is a organofluorine compound (CHEBI:37143) |
| cloransulam (CHEBI:131998) is a sulfonamide (CHEBI:35358) |
| cloransulam (CHEBI:131998) is a triazolopyrimidines (CHEBI:48435) |
| Incoming Relation(s) |
| cloransulam-methyl (CHEBI:3760) has functional parent cloransulam (CHEBI:131998) |
| IUPAC Name |
|---|
| 3-chloro-2-{[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| 3-chloro-2-[[(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonyl]amino]benzoic acid | Alan Wood's Pesticides |
| 3-chloro-2-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamido)benzoic acid | Alan Wood's Pesticides |
| 3-chloro-N-(5-ethoxy-7-fluoro[1,2,4]triazolo[1,5-c]pyrimidin-2-ylsulfonyl)anthranilic acid | Alan Wood's Pesticides |
| cloransulame | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| cloransulam | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8724593 | Reaxys |
| CAS:159518-97-5 | ChemIDplus |
| CAS:159518-97-5 | Alan Wood's Pesticides |