EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15ClO3 |
| Net Charge | 0 |
| Average Mass | 242.702 |
| Monoisotopic Mass | 242.07097 |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
| InChIKey | KNHUKKLJHYUCFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofibrate (CHEBI:3750) has functional parent clofibric acid (CHEBI:34648) |
| clofibrate (CHEBI:3750) has role anticholesteremic drug (CHEBI:35821) |
| clofibrate (CHEBI:3750) has role antilipemic drug (CHEBI:35679) |
| clofibrate (CHEBI:3750) has role geroprotector (CHEBI:176497) |
| clofibrate (CHEBI:3750) has role PPARα agonist (CHEBI:70782) |
| clofibrate (CHEBI:3750) is a aromatic ether (CHEBI:35618) |
| clofibrate (CHEBI:3750) is a ethyl ester (CHEBI:23990) |
| clofibrate (CHEBI:3750) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| INNs | Source |
|---|---|
| clofibrate | ChemIDplus |
| clofibrato | ChemIDplus |
| clofibratum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester | ChemIDplus |
| 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester | ChemIDplus |
| alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester | ChemIDplus |
| alpha-p-Chlorophenoxyisobutyryl ethyl ester | ChemIDplus |
| Clofibrate | KEGG COMPOUND |
| EPIB | DrugBank |
| Brand Names | Source |
|---|---|
| Atromid-S | KEGG DRUG |
| ELPI | DrugBank |
| Lipofacton | DrugBank |
| Citations |
|---|