EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15ClO3 |
| Net Charge | 0 |
| Average Mass | 242.702 |
| Monoisotopic Mass | 242.07097 |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
| InChIKey | KNHUKKLJHYUCFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofibrate (CHEBI:3750) has functional parent clofibric acid (CHEBI:34648) |
| clofibrate (CHEBI:3750) has role anticholesteremic drug (CHEBI:35821) |
| clofibrate (CHEBI:3750) has role antilipemic drug (CHEBI:35679) |
| clofibrate (CHEBI:3750) has role cardiovascular drug (CHEBI:35554) |
| clofibrate (CHEBI:3750) has role geroprotector (CHEBI:176497) |
| clofibrate (CHEBI:3750) has role PPARα agonist (CHEBI:70782) |
| clofibrate (CHEBI:3750) is a aromatic ether (CHEBI:35618) |
| clofibrate (CHEBI:3750) is a ethyl ester (CHEBI:23990) |
| clofibrate (CHEBI:3750) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| INNs | Source |
|---|---|
| clofibrate | ChemIDplus |
| clofibrato | ChemIDplus |
| clofibratum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester | ChemIDplus |
| 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester | ChemIDplus |
| alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester | ChemIDplus |
| alpha-p-Chlorophenoxyisobutyryl ethyl ester | ChemIDplus |
| AY-61123 | ChEMBL |
| Chlorfenisate | ChEMBL |
| Brand Names | Source |
|---|---|
| Atromid | ChEMBL |
| Atromid-S | KEGG DRUG |
| ELPI | DrugBank |
| Lipofacton | DrugBank |
| Citations |
|---|