EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClO3 |
| Net Charge | 0 |
| Average Mass | 214.648 |
| Monoisotopic Mass | 214.03967 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) |
| InChIKey | TXCGAZHTZHNUAI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| Applications: | herbicide A substance used to destroy plant pests. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofibric acid (CHEBI:34648) has functional parent isobutyric acid (CHEBI:16135) |
| clofibric acid (CHEBI:34648) has role anticholesteremic drug (CHEBI:35821) |
| clofibric acid (CHEBI:34648) has role antilipemic drug (CHEBI:35679) |
| clofibric acid (CHEBI:34648) has role antineoplastic agent (CHEBI:35610) |
| clofibric acid (CHEBI:34648) has role herbicide (CHEBI:24527) |
| clofibric acid (CHEBI:34648) has role marine xenobiotic metabolite (CHEBI:83399) |
| clofibric acid (CHEBI:34648) has role PPARα agonist (CHEBI:70782) |
| clofibric acid (CHEBI:34648) is a aromatic ether (CHEBI:35618) |
| clofibric acid (CHEBI:34648) is a monocarboxylic acid (CHEBI:25384) |
| clofibric acid (CHEBI:34648) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| clofibrate (CHEBI:3750) has functional parent clofibric acid (CHEBI:34648) |
| IUPAC Name |
|---|
| 2-(4-chlorophenoxy)-2-methylpropanoic acid |
| INNs | Source |
|---|---|
| acide clofibrique | ChemIDplus |
| acido clofibrico | ChemIDplus |
| acidum clofibricum | ChemIDplus |
| clofibric acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Chlorophenoxy)-2-methylpropionic acid | ChemIDplus |
| 2-(p-Chlorophenoxy)-2-methylpropionic acid | ChemIDplus |
| 2-(p-Chlorophenoxy)isobutyric acid | ChemIDplus |
| 4-CPIB | NIST Chemistry WebBook |
| Acide (p-chlorophenoxy)-2 methyl-2 propionique | ChemIDplus |
| Chlorfibrinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2940 | PPDB |
| 695 | DrugCentral |
| C13700 | KEGG COMPOUND |
| clofibric%20acid | Alan Wood's Pesticides |
| Clofibric_acid | Wikipedia |
| D07723 | KEGG DRUG |
| LSM-2427 | LINCS |
| Citations |
|---|