EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O2 |
| Net Charge | 0 |
| Average Mass | 210.232 |
| Monoisotopic Mass | 210.06808 |
| SMILES | Oc1ccc2c(ccc3ccccc32)c1O |
| InChI | InChI=1S/C14H10O2/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16/h1-8,15-16H |
| InChIKey | HNMUTKMLCMUDSB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenanthrene-1,2-diol (CHEBI:37452) is a phenanthrenediol (CHEBI:37453) |
| Incoming Relation(s) |
| 1,2-dihydrophenanthrene-1,2-diol (CHEBI:37475) has functional parent phenanthrene-1,2-diol (CHEBI:37452) |
| 2-hydroxy-1-phenanthryl β-D-glucopyranoside (CHEBI:19593) has functional parent phenanthrene-1,2-diol (CHEBI:37452) |
| IUPAC Name |
|---|
| phenanthrene-1,2-diol |
| Synonym | Source |
|---|---|
| 1,2-dihydroxyphenanthrene | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0546 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2579683 | Beilstein |