EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | OC[C@H]1O[C@@H](Oc2c(O)ccc3c2ccc2ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20O7/c21-9-15-16(23)17(24)18(25)20(26-15)27-19-13-6-5-10-3-1-2-4-11(10)12(13)7-8-14(19)22/h1-8,15-18,20-25H,9H2/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | RZPVCCLYHPVIAO-NUABRCLCSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-1-phenanthryl β-D-glucopyranoside (CHEBI:19593) has functional parent phenanthrene-1,2-diol (CHEBI:37452) |
| 2-hydroxy-1-phenanthryl β-D-glucopyranoside (CHEBI:19593) is a phenanthryl β-D-glucopyranoside (CHEBI:25963) |
| IUPAC Name |
|---|
| 2-hydroxyphenanthren-1-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-Hydroxy-1-phenanthryl-beta-D-glucopyranoside | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0547 | UM-BBD |