EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26ClNO.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 459.970 |
| Monoisotopic Mass | 459.18125 |
| SMILES | O=C(O)/C=C/C(=O)O.[H][C@]1(CCO[C@](C)(c2ccccc2)c2ccc(Cl)cc2)CCCN1C |
| InChI | InChI=1S/C21H26ClNO.C4H4O4/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2;5-3(6)1-2-4(7)8/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t20-,21-;/m1./s1 |
| InChIKey | PMGQWSIVQFOFOQ-YKVZVUFRSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clemastine fumarate (CHEBI:3739) has part clemastine (CHEBI:3738) |
| clemastine fumarate (CHEBI:3739) has role anti-allergic agent (CHEBI:50857) |
| clemastine fumarate (CHEBI:3739) has role antipruritic drug (CHEBI:59683) |
| clemastine fumarate (CHEBI:3739) has role H1-receptor antagonist (CHEBI:37955) |
| clemastine fumarate (CHEBI:3739) has role muscarinic antagonist (CHEBI:48876) |
| clemastine fumarate (CHEBI:3739) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidinium (2E)-3-carboxyprop-2-enoate | IUPAC |
| (+)-(2R)-2-(2-(((R)-p-chloro-α-methyl-α-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine fumarate (1:1) | ChemIDplus |
| clemastine hydrogen fumarate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6472482 | Beilstein |
| CAS:14976-57-9 | KEGG DRUG |
| CAS:14976-57-9 | ChemIDplus |