EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26ClNO |
| Net Charge | 0 |
| Average Mass | 343.898 |
| Monoisotopic Mass | 343.17029 |
| SMILES | [H][C@]1(CCO[C@](C)(c2ccccc2)c2ccc(Cl)cc2)CCCN1C |
| InChI | InChI=1S/C21H26ClNO/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | YNNUSGIPVFPVBX-NHCUHLMSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clemastine (CHEBI:3738) has role anti-allergic agent (CHEBI:50857) |
| clemastine (CHEBI:3738) has role antipruritic drug (CHEBI:59683) |
| clemastine (CHEBI:3738) has role H1-receptor antagonist (CHEBI:37955) |
| clemastine (CHEBI:3738) has role muscarinic antagonist (CHEBI:48876) |
| clemastine (CHEBI:3738) is a N-alkylpyrrolidine (CHEBI:46775) |
| clemastine (CHEBI:3738) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| clemastine fumarate (CHEBI:3739) has part clemastine (CHEBI:3738) |
| IUPAC Name |
|---|
| (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine |
| INNs | Source |
|---|---|
| clemastine | ChemIDplus |
| clemastina | ChemIDplus |
| clemastinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Clemastine | KEGG COMPOUND |
| (+)-(2R)-2-(2-(((R)-p-chloro-α-methyl-α-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine | ChemIDplus |
| (+)-(2R)-2-[2-[[(R)-p-chloro-α-methyl-α-phenylbenzyl]oxy]ethyl]-1-methylpyrrolidine | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6486432 | Beilstein |
| CAS:15686-51-8 | KEGG COMPOUND |
| CAS:15686-51-8 | ChemIDplus |
| CAS:15686-51-8 | NIST Chemistry WebBook |
| Citations |
|---|