EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | CCCCC/C=C\CC/C=C/C(=O)O |
| InChI | InChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h6-7,10-11H,2-5,8-9H2,1H3,(H,13,14)/b7-6-,11-10+ |
| InChIKey | RFHKVLKBWQIQDY-JFEAUALZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-trans,6-cis)-dodeca-2,6-dienoic acid (CHEBI:37212) is a dodecadienoic acid (CHEBI:37211) |
| (2-trans,6-cis)-dodeca-2,6-dienoic acid (CHEBI:37212) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| (2-trans,6-cis)-dodeca-2,6-dienoyl-CoA (CHEBI:28387) has functional parent (2-trans,6-cis)-dodeca-2,6-dienoic acid (CHEBI:37212) |
| IUPAC Name |
|---|
| (2E,6Z)-dodeca-2,6-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030231 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:94088-26-3 | ChemIDplus |