EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | CCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h2-8H2,1H3,(H,12,13) |
| InChIKey | YXTHWTPUTHTODU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxodecanoic acid (CHEBI:37157) has functional parent decanoic acid (CHEBI:30813) |
| 3-oxodecanoic acid (CHEBI:37157) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxodecanoic acid (CHEBI:37157) is conjugate acid of 3-oxodecanoate (CHEBI:75923) |
| Incoming Relation(s) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has functional parent 3-oxodecanoic acid (CHEBI:37157) |
| 3-oxodecanoate (CHEBI:75923) is conjugate base of 3-oxodecanoic acid (CHEBI:37157) |
| IUPAC Name |
|---|
| 3-oxodecanoic acid |
| Synonyms | Source |
|---|---|
| 3-ketodecanoic acid | ChEBI |
| 3-oxocapric acid | ChEBI |
| β-ketocapric acid | ChEBI |
| β-ketodecanoic acid | ChEBI |
| β-oxodecanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060028 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1769971 | Beilstein |