EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52N7O18P3S |
| Net Charge | 0 |
| Average Mass | 935.777 |
| Monoisotopic Mass | 935.23024 |
| SMILES | CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C31H52N7O18P3S/c1-4-5-6-7-8-9-19(39)14-22(41)60-13-12-33-21(40)10-11-34-29(44)26(43)31(2,3)16-53-59(50,51)56-58(48,49)52-15-20-25(55-57(45,46)47)24(42)30(54-20)38-18-37-23-27(32)35-17-36-28(23)38/h17-18,20,24-26,30,42-43H,4-16H2,1-3H3,(H,33,40)(H,34,44)(H,48,49)(H,50,51)(H2,32,35,36)(H2,45,46,47)/t20-,24-,25-,26+,30-/m1/s1 |
| InChIKey | AZCVXMAPLHSIKY-HSJNEKGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has functional parent 3-oxodecanoic acid (CHEBI:37157) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has functional parent decanoyl-CoA (CHEBI:28493) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has role human metabolite (CHEBI:77746) |
| 3-oxodecanoyl-CoA (CHEBI:28528) has role mouse metabolite (CHEBI:75771) |
| 3-oxodecanoyl-CoA (CHEBI:28528) is a 3-oxo-fatty acyl-CoA (CHEBI:15489) |
| 3-oxodecanoyl-CoA (CHEBI:28528) is conjugate acid of 3-oxodecanoyl-CoA(4−) (CHEBI:62548) |
| Incoming Relation(s) |
| 3-oxodecanoyl-CoA(4−) (CHEBI:62548) is conjugate base of 3-oxodecanoyl-CoA (CHEBI:28528) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxodecanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-ketodecanoyl-CoA | ChEBI |
| 3-ketodecanoyl-coenzyme A | ChEBI |
| 3-Oxodecanoyl-CoA | KEGG COMPOUND |
| 3-oxodecanoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05265 | KEGG COMPOUND |
| CPD0-2123 | MetaCyc |
| HMDB0003939 | HMDB |
| Citations |
|---|