EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CC(C)CCCCCC(=O)O |
| InChI | InChI=1S/C9H18O2/c1-8(2)6-4-3-5-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | XZOYHFBNQHPJRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyloctanoic acid (CHEBI:37108) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 7-methyloctanoic acid (CHEBI:37108) is a medium-chain fatty acid (CHEBI:59554) |
| 7-methyloctanoic acid (CHEBI:37108) is a methyl-branched fatty acid (CHEBI:62499) |
| Incoming Relation(s) |
| 7-methyl-3-oxooctanoic acid (CHEBI:37107) has functional parent 7-methyloctanoic acid (CHEBI:37108) |
| 7-methyloctanoyl-CoA (CHEBI:140734) has functional parent 7-methyloctanoic acid (CHEBI:37108) |
| IUPAC Name |
|---|
| 7-methyloctanoic acid |
| Synonyms | Source |
|---|---|
| 7-methyl caprylic acid | LIPID MAPS |
| 7-methylcaprylic acid | ChEBI |
| 7-methyl-octanoic acid | ChEBI |
| 7-Methyl-octansäure | ChEBI |
| 7-Methyloctansäure | ChEBI |
| isononanic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1752332 | Reaxys |
| CAS:693-19-6 | ChemIDplus |