EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | CC(C)CCCC(=O)CC(=O)O |
| InChI | InChI=1S/C9H16O3/c1-7(2)4-3-5-8(10)6-9(11)12/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | HMJVYQBHXHOGRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyl-3-oxooctanoic acid (CHEBI:37107) has functional parent 7-methyloctanoic acid (CHEBI:37108) |
| 7-methyl-3-oxooctanoic acid (CHEBI:37107) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| Incoming Relation(s) |
| 7-methyl-3-oxooct-6-enoyl-CoA (CHEBI:52043) has functional parent 7-methyl-3-oxooctanoic acid (CHEBI:37107) |
| 7-methyl-3-oxooctanoyl-CoA (CHEBI:15506) has functional parent 7-methyl-3-oxooctanoic acid (CHEBI:37107) |
| IUPAC Name |
|---|
| 7-methyl-3-oxooctanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4858725 | Beilstein |