EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CCCC(O)CC(=O)O |
| InChI | InChI=1S/C6H12O3/c1-2-3-5(7)4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9) |
| InChIKey | HPMGFDVTYHWBAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyhexanoic acid (CHEBI:37035) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxyhexanoic acid (CHEBI:37035) is conjugate acid of 3-hydroxyhexanoate (CHEBI:20070) |
| Incoming Relation(s) |
| ethyl 3-hydroxyhexanoate (CHEBI:23997) has functional parent 3-hydroxyhexanoic acid (CHEBI:37035) |
| (S)-3-hydroxyhexanoic acid (CHEBI:37049) is a 3-hydroxyhexanoic acid (CHEBI:37035) |
| 3-hydroxyhexanoate (CHEBI:20070) is conjugate base of 3-hydroxyhexanoic acid (CHEBI:37035) |
| Synonym | Source |
|---|---|
| 3-Hydroxycaproic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1721818 | Beilstein |
| CAS:10191-24-9 | ChemIDplus |