EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | CCCC(O)CC(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-2-3-5(7)4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | HPMGFDVTYHWBAG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyhexanoate (CHEBI:20070) has functional parent hexanoate (CHEBI:17120) |
| 3-hydroxyhexanoate (CHEBI:20070) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 3-hydroxyhexanoate (CHEBI:20070) is conjugate base of 3-hydroxyhexanoic acid (CHEBI:37035) |
| Incoming Relation(s) |
| 3-hydroxyhexanoic acid (CHEBI:37035) is conjugate acid of 3-hydroxyhexanoate (CHEBI:20070) |