EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m1/s1 |
| InChIKey | OYIFNHCXNCRBQI-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-2-aminoadipic acid (CHEBI:37025) has role metabolite (CHEBI:25212) |
| D-2-aminoadipic acid (CHEBI:37025) is a 2-aminoadipic acid (CHEBI:37024) |
| D-2-aminoadipic acid (CHEBI:37025) is enantiomer of L-2-aminoadipic acid (CHEBI:37023) |
| Incoming Relation(s) |
| L-2-aminoadipic acid (CHEBI:37023) is enantiomer of D-2-aminoadipic acid (CHEBI:37025) |
| IUPAC Name |
|---|
| (2R)-2-aminohexanedioic acid |
| Synonym | Source |
|---|---|
| D-α-aminoadipic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724347 | Reaxys |
| CAS:7620-28-2 | ChemIDplus |
| Citations |
|---|