EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | N[C@@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | OYIFNHCXNCRBQI-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-aminoadipic acid (CHEBI:37023) has functional parent adipic acid (CHEBI:30832) |
| L-2-aminoadipic acid (CHEBI:37023) has role Escherichia coli metabolite (CHEBI:76971) |
| L-2-aminoadipic acid (CHEBI:37023) has role human metabolite (CHEBI:77746) |
| L-2-aminoadipic acid (CHEBI:37023) is a 2-aminoadipic acid (CHEBI:37024) |
| L-2-aminoadipic acid (CHEBI:37023) is conjugate acid of L-2-aminoadipate(1−) (CHEBI:58672) |
| L-2-aminoadipic acid (CHEBI:37023) is conjugate acid of L-2-aminoadipate(2−) (CHEBI:17082) |
| L-2-aminoadipic acid (CHEBI:37023) is enantiomer of D-2-aminoadipic acid (CHEBI:37025) |
| Incoming Relation(s) |
| N-acetyl-L-2-aminoadipic acid 6-phosphate (CHEBI:31887) has functional parent L-2-aminoadipic acid (CHEBI:37023) |
| L-2-aminoadipate(1−) (CHEBI:58672) is conjugate base of L-2-aminoadipic acid (CHEBI:37023) |
| L-2-aminoadipate(2−) (CHEBI:17082) is conjugate base of L-2-aminoadipic acid (CHEBI:37023) |
| D-2-aminoadipic acid (CHEBI:37025) is enantiomer of L-2-aminoadipic acid (CHEBI:37023) |
| IUPAC Name |
|---|
| (2S)-2-aminohexanedioic acid |
| Synonyms | Source |
|---|---|
| (S)-2-aminohexanedioic acid | ChemIDplus |
| L-2-Aminoadipate | KEGG COMPOUND |
| L-2-Aminoadipic acid | KEGG COMPOUND |
| L-2-Aminohexanedioate | KEGG COMPOUND |
| L-alpha-Aminoadipate | KEGG COMPOUND |
| L-alpha-Aminoadipic acid | KEGG COMPOUND |
| Citations |
|---|