EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NS |
| Net Charge | 0 |
| Average Mass | 295.451 |
| Monoisotopic Mass | 295.13947 |
| SMILES | CN(C)CC/C=C1\c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11+ |
| InChIKey | PHTUQLWOUWZIMZ-GZTJUZNOSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-dothiepin (CHEBI:36803) is a dothiepin (CHEBI:36798) |
| Incoming Relation(s) |
| trans-dothiepin hydrochloride (CHEBI:36805) has part trans-dothiepin (CHEBI:36803) |
| Synonym | Source |
|---|---|
| (3E)-3-dibenzo[b,e]thiepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 951 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3616619 | Beilstein |