EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NS |
| Net Charge | 0 |
| Average Mass | 295.451 |
| Monoisotopic Mass | 295.13947 |
| SMILES | [H]C(CCN(C)C)=C1c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3 |
| InChIKey | PHTUQLWOUWZIMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dothiepin (CHEBI:36798) has role anticoronaviral agent (CHEBI:149553) |
| dothiepin (CHEBI:36798) has role antidepressant (CHEBI:35469) |
| dothiepin (CHEBI:36798) is a dibenzothiepine (CHEBI:38924) |
| Incoming Relation(s) |
| dothiepin hydrochloride (CHEBI:31519) has part dothiepin (CHEBI:36798) |
| cis-dothiepin (CHEBI:36802) is a dothiepin (CHEBI:36798) |
| trans-dothiepin (CHEBI:36803) is a dothiepin (CHEBI:36798) |
| IUPAC Name |
|---|
| 3-dibenzo[b,e]thiepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 3-dibenzo[b,e]thiepin-11(6H)-ylidene-N,N-dimethyl-1-propanamine | NIST Chemistry WebBook |
| dosulepin | ChemIDplus |
| dothiepin | ChemIDplus |
| N,N-dimethyldibenzo[b,e]thiepin-Δ11(6H),γ-propylamine | NIST Chemistry WebBook |