EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NOS |
| Net Charge | 0 |
| Average Mass | 297.423 |
| Monoisotopic Mass | 297.11874 |
| SMILES | CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/t17-/m0/s1 |
| InChIKey | ZEUITGRIYCTCEM-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-duloxetine (CHEBI:36795) is a duloxetine (CHEBI:36796) |
| (S)-duloxetine (CHEBI:36795) is enantiomer of (R)-duloxetine (CHEBI:36797) |
| Incoming Relation(s) |
| (S)-duloxetine hydrochloride (CHEBI:31526) has part (S)-duloxetine (CHEBI:36795) |
| (R)-duloxetine (CHEBI:36797) is enantiomer of (S)-duloxetine (CHEBI:36795) |
| IUPAC Name |
|---|
| (3S)-N-methyl-3-(naphthalen-1-yloxy)-3-(2-thienyl)propan-1-amine |
| Synonyms | Source |
|---|---|
| (3S)-N-methyl-3-(1-naphthyloxy)-3-(2-thienyl)propan-1-amine | IUPAC |
| (S)-duloxetine | ChemIDplus |
| LY 248686 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 972 | DrugCentral |
| DB00476 | DrugBank |
| Duloxetine | Wikipedia |
| LSM-3591 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4297128 | Beilstein |
| CAS:116539-59-4 | ChemIDplus |