EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NOS.HCl |
| Net Charge | 0 |
| Average Mass | 333.884 |
| Monoisotopic Mass | 333.09541 |
| SMILES | CNCC[C@H](Oc1cccc2ccccc12)c1cccs1.Cl |
| InChI | InChI=1S/C18H19NOS.ClH/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16;/h2-10,13,17,19H,11-12H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | BFFSMCNJSOPUAY-LMOVPXPDSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-duloxetine hydrochloride (CHEBI:31526) has part (S)-duloxetine (CHEBI:36795) |
| (S)-duloxetine hydrochloride (CHEBI:31526) has role antidepressant (CHEBI:35469) |
| (S)-duloxetine hydrochloride (CHEBI:31526) is a duloxetine hydrochloride (CHEBI:36808) |
| IUPAC Name |
|---|
| (3S)-N-methyl-3-(naphthalen-1-yloxy)-3-(2-thienyl)propan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| duloxetine hydrochloride | ChemIDplus |
| Cymbalta | ChemIDplus |
| (3S)-N-methyl-3-(1-naphthyloxy)-3-(2-thienyl)propan-1-amine hydrochloride | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| D01179 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8168890 | Reaxys |
| CAS:136434-34-9 | ChemIDplus |