EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36751 - pyrrole-2-carboxylic acid
| Formula | C5H5NO2 |
| Net Charge | 0 |
| Average Mass | 111.100 |
| Monoisotopic Mass | 111.03203 |
| SMILES | O=C(O)c1cccn1 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8) |
| InChIKey | WRHZVMBBRYBTKZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrole-2-carboxylic acid (CHEBI:36751) has role plant metabolite (CHEBI:76924) |
| pyrrole-2-carboxylic acid (CHEBI:36751) is a pyrrolecarboxylic acid (CHEBI:26454) |
| pyrrole-2-carboxylic acid (CHEBI:36751) is conjugate acid of pyrrole-2-carboxylate (CHEBI:27660) |
| Incoming Relation(s) |
| pyrrole-2-carboxylate (CHEBI:27660) is conjugate base of pyrrole-2-carboxylic acid (CHEBI:36751) |
| IUPAC Name |
|---|
| 1H-pyrrole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-pyrrolecarboxylic acid | ChemIDplus |
| Minaline | ChemIDplus |
| PCA | NIST Chemistry WebBook |
| Pyrrole-2-carboxylate | KEGG COMPOUND |
| pyrrole-2-carboxylic acid | NIST Chemistry WebBook |
| Citations |
|---|