EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4NO2 |
| Net Charge | -1 |
| Average Mass | 110.092 |
| Monoisotopic Mass | 110.02475 |
| SMILES | O=C([O-])c1cccn1 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8)/p-1 |
| InChIKey | WRHZVMBBRYBTKZ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrole-2-carboxylate (CHEBI:27660) is a pyrrolecarboxylate (CHEBI:26452) |
| pyrrole-2-carboxylate (CHEBI:27660) is conjugate base of pyrrole-2-carboxylic acid (CHEBI:36751) |
| Incoming Relation(s) |
| pyrrole-2-carboxylic acid (CHEBI:36751) is conjugate acid of pyrrole-2-carboxylate (CHEBI:27660) |
| IUPAC Name |
|---|
| 1H-pyrrole-2-carboxylate |
| UniProt Name | Source |
|---|---|
| pyrrole-2-carboxylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1006285 | Gmelin |
| Beilstein:3663073 | Beilstein |