EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO3 |
| Net Charge | 0 |
| Average Mass | 165.148 |
| Monoisotopic Mass | 165.04259 |
| SMILES | O=CNc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H7NO3/c10-5-9-7-4-2-1-3-6(7)8(11)12/h1-5H,(H,9,10)(H,11,12) |
| InChIKey | LLLPDUXGHXIXIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylanthranilic acid (CHEBI:36575) has functional parent anthranilic acid (CHEBI:30754) |
| N-formylanthranilic acid (CHEBI:36575) is a amidobenzoic acid (CHEBI:48470) |
| N-formylanthranilic acid (CHEBI:36575) is conjugate acid of N-formylanthranilate (CHEBI:18410) |
| Incoming Relation(s) |
| N-formylanthranilate (CHEBI:18410) is conjugate base of N-formylanthranilic acid (CHEBI:36575) |
| Synonyms | Source |
|---|---|
| 2-(Formylamino)-benzoic acid | KEGG COMPOUND |
| 2-(Formylamino)benzoic acid | ChemIDplus |