EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6NO3 |
| Net Charge | -1 |
| Average Mass | 164.140 |
| Monoisotopic Mass | 164.03532 |
| SMILES | O=CNc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H7NO3/c10-5-9-7-4-2-1-3-6(7)8(11)12/h1-5H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | LLLPDUXGHXIXIW-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylanthranilate (CHEBI:18410) has functional parent anthranilate (CHEBI:16567) |
| N-formylanthranilate (CHEBI:18410) has role human metabolite (CHEBI:77746) |
| N-formylanthranilate (CHEBI:18410) is a amidobenzoate (CHEBI:61666) |
| N-formylanthranilate (CHEBI:18410) is conjugate base of N-formylanthranilic acid (CHEBI:36575) |
| Incoming Relation(s) |
| N-formylanthranilic acid (CHEBI:36575) is conjugate acid of N-formylanthranilate (CHEBI:18410) |
| IUPAC Name |
|---|
| 2-formamidobenzoate |
| Synonyms | Source |
|---|---|
| 2-(formylamino)benzoate | ChEBI |
| Formylanthranilate | KEGG COMPOUND |
| N-Formylanthranilate | KEGG COMPOUND |
| N-formylanthranilate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-formylanthranilate | UniProt |