EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3655 - chlorzoxazone
| Formula | C7H4ClNO2 |
| Net Charge | 0 |
| Average Mass | 169.567 |
| Monoisotopic Mass | 168.99306 |
| SMILES | Oc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C7H4ClNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| InChIKey | TZFWDZFKRBELIQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorzoxazone (CHEBI:3655) has role muscle relaxant (CHEBI:51371) |
| chlorzoxazone (CHEBI:3655) has role sedative (CHEBI:35717) |
| chlorzoxazone (CHEBI:3655) is a 1,3-benzoxazoles (CHEBI:51548) |
| chlorzoxazone (CHEBI:3655) is a heteroaryl hydroxy compound (CHEBI:74818) |
| chlorzoxazone (CHEBI:3655) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5-chloro-1,3-benzoxazol-2-ol |
| INNs | Source |
|---|---|
| chlorzoxazona | ChemIDplus |
| chlorzoxazone | WHO MedNet |
| chlorzoxazone | ChemIDplus |
| chlorzoxazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-hydroxy-5-chlorobenzoxazole | ChemIDplus |
| 5-chloro-2(3H)-benzoxazolone | ChEBI |
| 5-chloro-2-benzoxazolinone | NIST Chemistry WebBook |
| 5-chloro-2-benzoxazolol | NIST Chemistry WebBook |
| 5-chloro-2-benzoxazolone | NIST Chemistry WebBook |
| 5-chloro-2-hydroxybenzoxazole | ChemIDplus |
| Citations |
|---|