EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36503 - menthone
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1CCC(C(C)C)C(=O)C1 |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3 |
| InChIKey | NFLGAXVYCFJBMK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menthone (CHEBI:36503) is a p-menthan-3-one (CHEBI:36742) |
| Incoming Relation(s) |
| (+)-menthone (CHEBI:31) is a menthone (CHEBI:36503) |
| (−)-menthone (CHEBI:15410) is a menthone (CHEBI:36503) |
| IUPAC Name |
|---|
| rel-(2R,5S)-5-methyl-2-(propan-2-yl)cyclohexanone |
| Synonyms | Source |
|---|---|
| (2R,5S)-rel-5-methyl-2-(1-methylethyl)cyclohexanone | ChemIDplus |
| rel-(1R,4S)-p-menthan-3-one | IUPAC |
| rel-(2R,5S)-2-isopropyl-5-methylcyclohexanone | IUPAC |
| trans-5-methyl-2-(1-methylethyl)cyclohexanone | NIST Chemistry WebBook |
| trans-p-menthan-3-one | NIST Chemistry WebBook |
| trans-menthan-3-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| menthone | UniProt |