EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)[C@H]1CC[C@H](C)CC1=O |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | NFLGAXVYCFJBMK-DTWKUNHWSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-menthone (CHEBI:31) is a menthone (CHEBI:36503) |
| (+)-menthone (CHEBI:31) is enantiomer of (−)-menthone (CHEBI:15410) |
| Incoming Relation(s) |
| (4S,7R)-7-isopropyl-4-methyloxepan-2-one (CHEBI:138383) has functional parent (+)-menthone (CHEBI:31) |
| (−)-menthone (CHEBI:15410) is enantiomer of (+)-menthone (CHEBI:31) |
| IUPAC Name |
|---|
| (2R,5S)-5-methyl-2-(propan-2-yl)cyclohexanone |
| Synonyms | Source |
|---|---|
| (1S,4R)-p-menthan-3-one | IUPAC |
| (2R,5S)-2-isopropyl-5-methylcyclohexanone | IUPAC |
| (+)-Menthone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,4R)-menthone | UniProt |