EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O4 |
| Net Charge | -1 |
| Average Mass | 141.102 |
| Monoisotopic Mass | 141.01933 |
| SMILES | O=C([O-])/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/p-1/b3-1+,4-2+ |
| InChIKey | TXXHDPDFNKHHGW-ZPUQHVIOSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) has role human xenobiotic metabolite (CHEBI:76967) |
| (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) is a dicarboxylic acid monoanion (CHEBI:35695) |
| (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) is conjugate acid of trans,trans-muconate (CHEBI:27035) |
| (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) is conjugate base of trans,trans-muconic acid (CHEBI:27036) |
| Incoming Relation(s) |
| trans,trans-muconic acid (CHEBI:27036) is conjugate acid of (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) |
| trans,trans-muconate (CHEBI:27035) is conjugate base of (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) |
| IUPAC Name |
|---|
| (2E,4E)-5-carboxypenta-2,4-dienoate |