EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O4 |
| Net Charge | -2 |
| Average Mass | 140.094 |
| Monoisotopic Mass | 140.01206 |
| SMILES | O=C([O-])/C=C/C=C/C(=O)[O-] |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/p-2/b3-1+,4-2+ |
| InChIKey | TXXHDPDFNKHHGW-ZPUQHVIOSA-L |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans,trans-muconate (CHEBI:27035) has role human xenobiotic metabolite (CHEBI:76967) |
| trans,trans-muconate (CHEBI:27035) is a dicarboxylic acid dianion (CHEBI:28965) |
| trans,trans-muconate (CHEBI:27035) is a muconate (CHEBI:36157) |
| trans,trans-muconate (CHEBI:27035) is conjugate base of (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) |
| Incoming Relation(s) |
| (2E,4E)-5-carboxypenta-2,4-dienoate (CHEBI:36502) is conjugate acid of trans,trans-muconate (CHEBI:27035) |
| IUPAC Name |
|---|
| (2E,4E)-hexa-2,4-dienedioate |
| Synonyms | Source |
|---|---|
| (E,E)-muconate | ChEBI |
| trans,trans-Buta-1,3-diene-1,4-dicarboxylate | ChEBI |
| trans,trans-2,4-hexadienedioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5330368 | Reaxys |