EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19ClN2OS |
| Net Charge | 0 |
| Average Mass | 334.872 |
| Monoisotopic Mass | 334.09066 |
| SMILES | C[N+](C)([O-])CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H19ClN2OS/c1-20(2,21)11-5-10-19-14-6-3-4-7-16(14)22-17-9-8-13(18)12-15(17)19/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | LFDFWIIFGRXCFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorpromazine N-oxide (CHEBI:3648) has functional parent chlorpromazine (CHEBI:3647) |
| chlorpromazine N-oxide (CHEBI:3648) has role metabolite (CHEBI:25212) |
| chlorpromazine N-oxide (CHEBI:3648) is a organochlorine compound (CHEBI:36683) |
| chlorpromazine N-oxide (CHEBI:3648) is a phenothiazines (CHEBI:38093) |
| chlorpromazine N-oxide (CHEBI:3648) is a tertiary amine oxide (CHEBI:134363) |
| IUPAC Name |
|---|
| [3-(2-chloro-10H-phenothiazin-10-yl)propyl]dimethylamine oxide |
| Synonyms | Source |
|---|---|
| 2-chloro-10-(3'-dimethyloxidoaminopropyl)phenothiazine | ChEBI |
| Chlorpromazine N-oxide | KEGG COMPOUND |
| Citations |
|---|