EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19ClN2S |
| Net Charge | 0 |
| Average Mass | 318.873 |
| Monoisotopic Mass | 318.09575 |
| SMILES | CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorpromazine (CHEBI:3647) has role anticoronaviral agent (CHEBI:149553) |
| chlorpromazine (CHEBI:3647) has role antiemetic (CHEBI:50919) |
| chlorpromazine (CHEBI:3647) has role dopaminergic antagonist (CHEBI:48561) |
| chlorpromazine (CHEBI:3647) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| chlorpromazine (CHEBI:3647) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| chlorpromazine (CHEBI:3647) is a organochlorine compound (CHEBI:36683) |
| chlorpromazine (CHEBI:3647) is a phenothiazines (CHEBI:38093) |
| chlorpromazine (CHEBI:3647) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| chlorpromazine N-oxide (CHEBI:3648) has functional parent chlorpromazine (CHEBI:3647) |
| chlorpromazine hydrochloride (CHEBI:3649) has part chlorpromazine (CHEBI:3647) |
| IUPAC Name |
|---|
| 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
| INNs | Source |
|---|---|
| chlorpromazine | ChemIDplus |
| chlorpromazinum | ChemIDplus |
| clorpromazina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine | NIST Chemistry WebBook |
| 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine | IUPHAR |
| Chlorpromazine | KEGG COMPOUND |
| CPZ | ChemIDplus |
| N-(3-dimethylaminopropyl)-3-chlorophenothiazine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aminazine | ChemIDplus |
| Chlorderazin | ChemIDplus |
| Chloropromazine | IUPHAR |
| Chlorpromados | ChemIDplus |
| Contomin | ChemIDplus |
| Largactil | IUPHAR |
| Citations |
|---|