EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3647 - chlorpromazine
| Formula | C17H19ClN2S |
| Net Charge | 0 |
| Average Mass | 318.873 |
| Monoisotopic Mass | 318.09575 |
| SMILES | CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorpromazine (CHEBI:3647) has role anticoronaviral agent (CHEBI:149553) |
| chlorpromazine (CHEBI:3647) has role antiemetic (CHEBI:50919) |
| chlorpromazine (CHEBI:3647) has role dopaminergic antagonist (CHEBI:48561) |
| chlorpromazine (CHEBI:3647) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| chlorpromazine (CHEBI:3647) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| chlorpromazine (CHEBI:3647) is a organochlorine compound (CHEBI:36683) |
| chlorpromazine (CHEBI:3647) is a phenothiazines (CHEBI:38093) |
| chlorpromazine (CHEBI:3647) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| chlorpromazine N-oxide (CHEBI:3648) has functional parent chlorpromazine (CHEBI:3647) |
| chlorpromazine hydrochloride (CHEBI:3649) has part chlorpromazine (CHEBI:3647) |
| IUPAC Name |
|---|
| 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
| INNs | Source |
|---|---|
| chlorpromazinum | ChemIDplus |
| chlorpromazine | ChemIDplus |
| clorpromazina | ChemIDplus |
| Synonyms | Source |
|---|---|
| Chlorpromazine | KEGG COMPOUND |
| 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine | NIST Chemistry WebBook |
| N-(3-dimethylaminopropyl)-3-chlorophenothiazine | ChemIDplus |
| 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine | IUPHAR |
| CPZ | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aminazine | ChemIDplus |
| Chlorderazin | ChemIDplus |
| Contomin | ChemIDplus |
| Chlorpromados | ChemIDplus |
| Chloropromazine | IUPHAR |
| Largactil | IUPHAR |
| Citations |
|---|