EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C6H5O7 |
| Net Charge | -1 |
| Average Mass | 191.115 |
| Monoisotopic Mass | 191.01973 |
| SMILES | O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-1 |
| InChIKey | ODBLHEXUDAPZAU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocitrate(1−) (CHEBI:36454) is a tricarboxylic acid monoanion (CHEBI:36299) |
| isocitrate(1−) (CHEBI:36454) is conjugate acid of isocitrate(2−) (CHEBI:36453) |
| isocitrate(1−) (CHEBI:36454) is conjugate base of isocitric acid (CHEBI:30887) |
| Incoming Relation(s) |
| isocitric acid (CHEBI:30887) is conjugate acid of isocitrate(1−) (CHEBI:36454) |
| isocitrate(2−) (CHEBI:36453) is conjugate base of isocitrate(1−) (CHEBI:36454) |
| Synonym | Source |
|---|---|
| dihydrogen isocitrate | ChEBI |