EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C6H5O7 |
| Net Charge | -2 |
| Average Mass | 190.107 |
| Monoisotopic Mass | 190.01245 |
| SMILES | O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-].[H+] |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-2 |
| InChIKey | ODBLHEXUDAPZAU-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocitrate(2−) (CHEBI:36453) is a tricarboxylic acid dianion (CHEBI:36300) |
| isocitrate(2−) (CHEBI:36453) is conjugate acid of isocitrate(3−) (CHEBI:16087) |
| isocitrate(2−) (CHEBI:36453) is conjugate base of isocitrate(1−) (CHEBI:36454) |
| Incoming Relation(s) |
| isocitrate(1−) (CHEBI:36454) is conjugate acid of isocitrate(2−) (CHEBI:36453) |
| isocitrate(3−) (CHEBI:16087) is conjugate base of isocitrate(2−) (CHEBI:36453) |
| Synonym | Source |
|---|---|
| hydrogen isocitrate | ChEBI |