EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36361 - phosphorous acid
| Formula | H3O3P |
| Net Charge | 0 |
| Average Mass | 81.995 |
| Monoisotopic Mass | 81.98198 |
| SMILES | [H]OP(O[H])O[H] |
| InChI | InChI=1S/H3O3P/c1-4(2)3/h1-3H |
| InChIKey | OJMIONKXNSYLSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phosphorous acid (CHEBI:36361) is a phosphorus oxoacid (CHEBI:33457) |
| phosphorous acid (CHEBI:36361) is conjugate acid of dihydrogenphosphite (CHEBI:29258) |
| phosphorous acid (CHEBI:36361) is tautomer of phosphonic acid (CHEBI:44976) |
| Incoming Relation(s) |
| organic phosphite (CHEBI:48135) has functional parent phosphorous acid (CHEBI:36361) |
| phosphorous acid derivative (CHEBI:59749) has functional parent phosphorous acid (CHEBI:36361) |
| dihydrogenphosphite (CHEBI:29258) is conjugate base of phosphorous acid (CHEBI:36361) |
| phosphonic acid (CHEBI:44976) is tautomer of phosphorous acid (CHEBI:36361) |
| IUPAC Names |
|---|
| trihydrogen trioxophosphate(3−) |
| trioxophosphoric(3−) acid |
| trihydroxidophosphorus |
| Synonyms | Source |
|---|---|
| phosphorous acid | IUPAC |
| H3PO3 | IUPAC |
| H3PO3 | NIST Chemistry WebBook |
| P(OH)3 | IUPAC |
| [P(OH)3] | IUPAC |
| phosphorige Säure | ChEBI |
| UniProt Name | Source |
|---|---|
| phosphite | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:164068 | Gmelin |
| CAS:10294-56-1 | NIST Chemistry WebBook |
| CAS:10294-56-1 | ChemIDplus |