EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O5 |
| Net Charge | 0 |
| Average Mass | 246.218 |
| Monoisotopic Mass | 246.05282 |
| SMILES | O=c1cc(O)cc(/C=C/c2ccc(O)c(O)c2)o1 |
| InChI | InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+ |
| InChIKey | SGJNQVTUYXCBKH-HNQUOIGGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeolus schweinitzii (ncbitaxon:40476) | - | PubMed (29345559) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispidin (CHEBI:36332) has role antioxidant (CHEBI:22586) |
| hispidin (CHEBI:36332) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| hispidin (CHEBI:36332) has role fungal metabolite (CHEBI:76946) |
| hispidin (CHEBI:36332) is a 2-pyranones (CHEBI:75885) |
| hispidin (CHEBI:36332) is a catechols (CHEBI:33566) |
| hispidin (CHEBI:36332) is conjugate acid of hispidin(1−) (CHEBI:190288) |
| Incoming Relation(s) |
| hispidin(1−) (CHEBI:190288) is conjugate base of hispidin (CHEBI:36332) |
| IUPAC Name |
|---|
| 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-hydroxy-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| 6-(3,4-dihydroxystyryl)-4-hydroxy-2-pyrone | ChemIDplus |
| 6-[(E)-2-(3,4-dihydroxyphenyl)vinyl]-4-hydroxy-2H-pyran-2-one | IUPAC |
| hispidin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 13975015 | ChemSpider |
| C00043575 | KNApSAcK |
| Hispidin | Wikipedia |
| HMDB0253181 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1288087 | Beilstein |
| CAS:555-55-5 | ChemIDplus |
| Citations |
|---|