EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9O5 |
| Net Charge | -1 |
| Average Mass | 245.210 |
| Monoisotopic Mass | 245.04555 |
| SMILES | O=c1cc([O-])cc(/C=C/c2ccc(O)c(O)c2)o1 |
| InChI | InChI=1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/p-1/b3-1+ |
| InChIKey | SGJNQVTUYXCBKH-HNQUOIGGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispidin(1−) (CHEBI:190288) is a organic anion (CHEBI:25696) |
| hispidin(1−) (CHEBI:190288) is conjugate base of hispidin (CHEBI:36332) |
| Incoming Relation(s) |
| hispidin (CHEBI:36332) is conjugate acid of hispidin(1−) (CHEBI:190288) |
| IUPAC Name |
|---|
| 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-oxo-2H-pyran-4-olate |
| Synonym | Source |
|---|---|
| hispidin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| hispidin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-6989 | MetaCyc |
| Citations |
|---|