EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H5O6Te |
| Net Charge | -1 |
| Average Mass | 228.634 |
| Monoisotopic Mass | 230.91539 |
| SMILES | [H]O[Te]([O-])(O[H])(O[H])(O[H])O[H] |
| InChI | InChI=1S/H6O6Te/c1-7(2,3,4,5)6/h1-6H/p-1 |
| InChIKey | FXADMRZICBQPQY-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orthotellurate(1−) (CHEBI:36293) is a monovalent inorganic anion (CHEBI:79389) |
| orthotellurate(1−) (CHEBI:36293) is a orthotellurate ion (CHEBI:36289) |
| orthotellurate(1−) (CHEBI:36293) is conjugate acid of orthotellurate(2−) (CHEBI:36292) |
| orthotellurate(1−) (CHEBI:36293) is conjugate base of orthotelluric acid (CHEBI:30461) |
| Incoming Relation(s) |
| orthotelluric acid (CHEBI:30461) is conjugate acid of orthotellurate(1−) (CHEBI:36293) |
| orthotellurate(2−) (CHEBI:36292) is conjugate base of orthotellurate(1−) (CHEBI:36293) |
| IUPAC Names |
|---|
| pentahydrogen orthotellurate |
| pentahydroxidooxidotellurate(1−) |
| Synonyms | Source |
|---|---|
| H5TeO6− | IUPAC |
| [TeO(OH)5]− | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:240158 | Gmelin |